C22H35FN8O2 — CID 162366009
2-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]-N-[(3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-yl]piperidine-4-carboxamide (PubChem CID 162366009) has the molecular formula C22H35FN8O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]-N-[(3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-yl]piperidine-4-carboxamide.
| Compound Name | 2-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]-N-[(3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162366009 |
| Molecular Formula | C22H35FN8O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]-N-[(3R)-6-fluoro-2,3-dihydro-1-benzofuran-3-yl]piperidine-4-carboxamide |
| SMILES | CN1C(CNC2CC(C(=O)N[C@H]3COc4cc(F)ccc43)CCN2)NNC1C1CCNCN1 |
| InChI | InChI=1S/C22H35FN8O2/c1-31-20(29-30-21(31)16-5-6-24-12-27-16)10-26-19-8-13(4-7-25-19)22(32)28-17-11-33-18-9-14(23)2-3-15(17)18/h2-3,9,13,16-17,19-21,24-27,29-30H,4-8,10-12H2,1H3,(H,28,32)/t13?,16?,17-,19?,20?,21?/m0/s1 |
| InChIKey | KYAKUPMELJEFAY-CWCDQGMWSA-N |
| XLogP | -1.11 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |