C24H44N6O2 — CID 166579033
N-[(3R)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]-3-[(4-methyl-5-piperidin-4-yl-1,2,4-triazolidin-3-yl)methylamino]cyclohexane-1-carboxamide (PubChem CID 166579033) has the molecular formula C24H44N6O2 and a molecular weight of 448.66 g/mol. Its IUPAC name is N-[(3R)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]-3-[(4-methyl-5-piperidin-4-yl-1,2,4-triazolidin-3-yl)methylamino]cyclohexane-1-carboxamide.
| Compound Name | N-[(3R)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]-3-[(4-methyl-5-piperidin-4-yl-1,2,4-triazolidin-3-yl)methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166579033 |
| Molecular Formula | C24H44N6O2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | N-[(3R)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]-3-[(4-methyl-5-piperidin-4-yl-1,2,4-triazolidin-3-yl)methylamino]cyclohexane-1-carboxamide |
| SMILES | CN1C(CNC2CCCC(C(=O)N[C@H]3COC4CCCCC43)C2)NNC1C1CCNCC1 |
| InChI | InChI=1S/C24H44N6O2/c1-30-22(28-29-23(30)16-9-11-25-12-10-16)14-26-18-6-4-5-17(13-18)24(31)27-20-15-32-21-8-3-2-7-19(20)21/h16-23,25-26,28-29H,2-15H2,1H3,(H,27,31)/t17?,18?,19?,20-,21?,22?,23?/m0/s1 |
| InChIKey | QSJYRKWGIMIENV-FDVDEAANSA-N |
| XLogP | 0.90 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |