C24H44ClN7O2 — CID 166578975
N-[(4R)-7-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide (PubChem CID 166578975) has the molecular formula C24H44ClN7O2 and a molecular weight of 498.12 g/mol. Its IUPAC name is N-[(4R)-7-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide.
| Compound Name | N-[(4R)-7-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166578975 |
| Molecular Formula | C24H44ClN7O2 |
| Molecular Weight | 498.12 g/mol |
| Exact Mass | 497.32 |
| IUPAC Name | N-[(4R)-7-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(1,3-diazinan-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide |
| SMILES | CN1C(CNC2CCCC(C(=O)N[C@@H]3CCOC4CC(Cl)CCC43)C2)NNC1C1CCNCN1 |
| InChI | InChI=1S/C24H44ClN7O2/c1-32-22(30-31-23(32)20-7-9-26-14-28-20)13-27-17-4-2-3-15(11-17)24(33)29-19-8-10-34-21-12-16(25)5-6-18(19)21/h15-23,26-28,30-31H,2-14H2,1H3,(H,29,33)/t15?,16?,17?,18?,19-,20?,21?,22?,23?/m1/s1 |
| InChIKey | WMQYUPVXWQUEBK-JXCZLIOISA-N |
| XLogP | 0.42 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.12 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|