C25H45B2N7O3 — CID 162365651
CID 162365651 (PubChem CID 162365651) has the molecular formula C25H45B2N7O3 and a molecular weight of 513.31 g/mol.
| Compound Name | CID 162365651 |
|---|---|
| PubChem CID | 162365651 |
| Molecular Formula | C25H45B2N7O3 |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | — |
| SMILES | [B]C([B])(NC1CCCC(C(=O)NC2CCOC3CCCCC23)C1)C1NNC(C2CCNCN2)N1CCO |
| InChI | InChI=1S/C25H45B2N7O3/c26-25(27,24-33-32-22(34(24)11-12-35)20-8-10-28-15-29-20)31-17-5-3-4-16(14-17)23(36)30-19-9-13-37-21-7-2-1-6-18(19)21/h16-22,24,28-29,31-33,35H,1-15H2,(H,30,36) |
| InChIKey | ZGJFGYDYQYXTIX-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 121.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|