C25H45ClN6O2 — CID 166579171
N-[(4S)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(3-chloropiperidin-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide (PubChem CID 166579171) has the molecular formula C25H45ClN6O2 and a molecular weight of 497.13 g/mol. Its IUPAC name is N-[(4S)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(3-chloropiperidin-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide.
| Compound Name | N-[(4S)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(3-chloropiperidin-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166579171 |
| Molecular Formula | C25H45ClN6O2 |
| Molecular Weight | 497.13 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | N-[(4S)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-[[5-(3-chloropiperidin-4-yl)-4-methyl-1,2,4-triazolidin-3-yl]methylamino]cyclohexane-1-carboxamide |
| SMILES | CN1C(CNC2CCCC(C(=O)N[C@H]3CCOC4CCCCC43)C2)NNC1C1CCNCC1Cl |
| InChI | InChI=1S/C25H45ClN6O2/c1-32-23(30-31-24(32)18-9-11-27-14-20(18)26)15-28-17-6-4-5-16(13-17)25(33)29-21-10-12-34-22-8-3-2-7-19(21)22/h16-24,27-28,30-31H,2-15H2,1H3,(H,29,33)/t16?,17?,18?,19?,20?,21-,22?,23?,24?/m0/s1 |
| InChIKey | DJSFDPJCJAERED-RVBZEIECSA-N |
| XLogP | 1.51 |
| TPSA | 89.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.13 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|