C26H47ClN6O3 — CID 166579451
3-[[2-amino-2-(5-amino-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[4,3-f][1,4]oxazepin-4-yl)ethyl]amino]-N-[(4R)-8-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]cyclohexane-1-carboxamide (PubChem CID 166579451) has the molecular formula C26H47ClN6O3 and a molecular weight of 527.15 g/mol. Its IUPAC name is 3-[[2-amino-2-(5-amino-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[4,3-f][1,4]oxazepin-4-yl)ethyl]amino]-N-[(4R)-8-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]cyclohexane-1-carboxamide.
| Compound Name | 3-[[2-amino-2-(5-amino-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[4,3-f][1,4]oxazepin-4-yl)ethyl]amino]-N-[(4R)-8-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166579451 |
| Molecular Formula | C26H47ClN6O3 |
| Molecular Weight | 527.15 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 3-[[2-amino-2-(5-amino-3,5,5a,6,7,8,9,9a-octahydro-2H-pyrido[4,3-f][1,4]oxazepin-4-yl)ethyl]amino]-N-[(4R)-8-chloro-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]cyclohexane-1-carboxamide |
| SMILES | NC(CNC1CCCC(C(=O)N[C@@H]2CCOC3C(Cl)CCCC32)C1)N1CCOC2CNCCC2C1N |
| InChI | InChI=1S/C26H47ClN6O3/c27-20-6-2-5-18-21(8-11-36-24(18)20)32-26(34)16-3-1-4-17(13-16)31-15-23(28)33-10-12-35-22-14-30-9-7-19(22)25(33)29/h16-25,30-31H,1-15,28-29H2,(H,32,34)/t16?,17?,18?,19?,20?,21-,22?,23?,24?,25?/m1/s1 |
| InChIKey | RQBRJMJPAMMCLI-BFJAMDSBSA-N |
| XLogP | 0.70 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|