C33H37FN6O5S — CID 162366063
4-[4-[3-[(4Z)-cyclooct-4-en-1-yl]oxypropyl]-5-[[3-[(3-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1,2,4-triazol-3-yl]pyridine (PubChem CID 162366063) has the molecular formula C33H37FN6O5S and a molecular weight of 648.76 g/mol. Its IUPAC name is 4-[4-[3-[(4Z)-cyclooct-4-en-1-yl]oxypropyl]-5-[[3-[(3-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[4-[3-[(4Z)-cyclooct-4-en-1-yl]oxypropyl]-5-[[3-[(3-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 162366063 |
| Molecular Formula | C33H37FN6O5S |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | 4-[4-[3-[(4Z)-cyclooct-4-en-1-yl]oxypropyl]-5-[[3-[(3-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1,2,4-triazol-3-yl]pyridine |
| SMILES | O=C(NCc1cccc(OS(=O)(=O)F)c1)c1cccc(NCc2nnc(-c3ccncc3)n2CCCOC2CC/C=C\CCC2)c1 |
| InChI | InChI=1S/C33H37FN6O5S/c34-46(42,43)45-30-14-6-9-25(21-30)23-37-33(41)27-10-7-11-28(22-27)36-24-31-38-39-32(26-15-17-35-18-16-26)40(31)19-8-20-44-29-12-4-2-1-3-5-13-29/h1-2,6-7,9-11,14-18,21-22,29,36H,3-5,8,12-13,19-20,23-24H2,(H,37,41)/b2-1- |
| InChIKey | CMWZLCCHFGBICT-UPHRSURJSA-N |
| XLogP | 5.77 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|