C24H19FN6O4S — CID 162366189
4-[5-[[3-[(3-ethynyl-5-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1H-1,2,4-triazol-3-yl]pyridine (PubChem CID 162366189) has the molecular formula C24H19FN6O4S and a molecular weight of 506.52 g/mol. Its IUPAC name is 4-[5-[[3-[(3-ethynyl-5-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1H-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[5-[[3-[(3-ethynyl-5-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1H-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 162366189 |
| Molecular Formula | C24H19FN6O4S |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[5-[[3-[(3-ethynyl-5-fluorosulfonyloxyphenyl)methylcarbamoyl]anilino]methyl]-1H-1,2,4-triazol-3-yl]pyridine |
| SMILES | C#Cc1cc(CNC(=O)c2cccc(NCc3nc(-c4ccncc4)n[nH]3)c2)cc(OS(=O)(=O)F)c1 |
| InChI | InChI=1S/C24H19FN6O4S/c1-2-16-10-17(12-21(11-16)35-36(25,33)34)14-28-24(32)19-4-3-5-20(13-19)27-15-22-29-23(31-30-22)18-6-8-26-9-7-18/h1,3-13,27H,14-15H2,(H,28,32)(H,29,30,31) |
| InChIKey | NVQHKZUCZGVDDV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|