C20H19ClN6O — CID 162368329
2-chloro-4-[[4-(4-methylpiperazin-1-yl)-2-oxo-1H-quinolin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 162368329) has the molecular formula C20H19ClN6O and a molecular weight of 394.87 g/mol. Its IUPAC name is 2-chloro-4-[[4-(4-methylpiperazin-1-yl)-2-oxo-1H-quinolin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[4-(4-methylpiperazin-1-yl)-2-oxo-1H-quinolin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162368329 |
| Molecular Formula | C20H19ClN6O |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-chloro-4-[[4-(4-methylpiperazin-1-yl)-2-oxo-1H-quinolin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CN1CCN(c2cc(=O)[nH]c3ccc(Nc4ccnc(Cl)c4C#N)cc23)CC1 |
| InChI | InChI=1S/C20H19ClN6O/c1-26-6-8-27(9-7-26)18-11-19(28)25-16-3-2-13(10-14(16)18)24-17-4-5-23-20(21)15(17)12-22/h2-5,10-11H,6-9H2,1H3,(H,23,24)(H,25,28) |
| InChIKey | SYEISTIQVVVHKQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|