About (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine
(Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine (PubChem CID 162369022) has the molecular formula C17H15FN2O2
and a molecular weight of 298.32 g/mol. Its IUPAC name is (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine |
| PubChem CID | 162369022 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine |
| SMILES | NC/C(=C/F)COc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H15FN2O2/c18-9-12(10-19)11-21-14-7-5-13(6-8-14)17-20-15-3-1-2-4-16(15)22-17/h1-9H,10-11,19H2/b12-9- |
| InChIKey | HSDOLWWRACNOBG-XFXZXTDPSA-N |
| XLogP | 3.69 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The IUPAC name of (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine (CID 162369022) is (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine.
What is the SMILES notation for (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The canonical SMILES for (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine is NC/C(=C/F)COc1ccc(-c2nc3ccccc3o2)cc1.
What is the InChIKey of (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
The InChIKey is HSDOLWWRACNOBG-XFXZXTDPSA-N. The full InChI is InChI=1S/C17H15FN2O2/c18-9-12(10-19)11-21-14-7-5-13(6-8-14)17-20-15-3-1-2-4-16(15)22-17/h1-9H,10-11,19H2/b12-9-.
What are the key properties of (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine?
(Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine has a molecular weight of 298.32 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[[4-(1,3-benzoxazol-2-yl)phenoxy]methyl]-3-fluoroprop-2-en-1-amine is sourced from PubChem (CID 162369022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).