C21H25NO2 — CID 162370146
3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 162370146) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | 3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 162370146 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | O=C(/C=C/C1CC1)C1C(=O)NC2CCCCC2C1c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c23-18(13-12-14-10-11-14)20-19(15-6-2-1-3-7-15)16-8-4-5-9-17(16)22-21(20)24/h1-3,6-7,12-14,16-17,19-20H,4-5,8-11H2,(H,22,24)/b13-12+ |
| InChIKey | JWPZZMFUFKVDBC-OUKQBFOZSA-N |
| XLogP | 3.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|