C25H27NO2 — CID 178201996
6-methyl-4-phenyl-3-[(Z)-3-phenylprop-2-enoyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 178201996) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 6-methyl-4-phenyl-3-[(Z)-3-phenylprop-2-enoyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | 6-methyl-4-phenyl-3-[(Z)-3-phenylprop-2-enoyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 178201996 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 6-methyl-4-phenyl-3-[(Z)-3-phenylprop-2-enoyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | CC1CCC2NC(=O)C(C(=O)/C=C\c3ccccc3)C(c3ccccc3)C2C1 |
| InChI | InChI=1S/C25H27NO2/c1-17-12-14-21-20(16-17)23(19-10-6-3-7-11-19)24(25(28)26-21)22(27)15-13-18-8-4-2-5-9-18/h2-11,13,15,17,20-21,23-24H,12,14,16H2,1H3,(H,26,28)/b15-13- |
| InChIKey | ZCWAIXYOPMSUEV-SQFISAMPSA-N |
| XLogP | 4.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|