C25H20F3NO3 — CID 162371528
(E)-3-[2-[[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 162371528) has the molecular formula C25H20F3NO3 and a molecular weight of 439.43 g/mol. Its IUPAC name is (E)-3-[2-[[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162371528 |
| Molecular Formula | C25H20F3NO3 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (E)-3-[2-[[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccccc1CN(Cc1ccccc1C(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20F3NO3/c26-25(27,28)22-13-7-6-12-21(22)17-29(24(32)19-9-2-1-3-10-19)16-20-11-5-4-8-18(20)14-15-23(30)31/h1-15H,16-17H2,(H,30,31)/b15-14+ |
| InChIKey | MLEMLVXJDLNSBK-CCEZHUSRSA-N |
| XLogP | 5.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|