C29H28F3NO3 — CID 162371506
ethyl (E)-3-[2-[1-[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propyl]phenyl]prop-2-enoate (PubChem CID 162371506) has the molecular formula C29H28F3NO3 and a molecular weight of 495.54 g/mol. Its IUPAC name is ethyl (E)-3-[2-[1-[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[1-[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162371506 |
| Molecular Formula | C29H28F3NO3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | ethyl (E)-3-[2-[1-[benzoyl-[[2-(trifluoromethyl)phenyl]methyl]amino]propyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccccc1C(CC)N(Cc1ccccc1C(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28F3NO3/c1-3-26(24-16-10-8-12-21(24)18-19-27(34)36-4-2)33(28(35)22-13-6-5-7-14-22)20-23-15-9-11-17-25(23)29(30,31)32/h5-19,26H,3-4,20H2,1-2H3/b19-18+ |
| InChIKey | HMIVHHZHBNQCHX-VHEBQXMUSA-N |
| XLogP | 7.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|