C12H13N5O2S — CID 162371685
[6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-nitropyrimidin-4-yl] thiocyanate (PubChem CID 162371685) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-nitropyrimidin-4-yl] thiocyanate.
| Compound Name | [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-nitropyrimidin-4-yl] thiocyanate |
|---|---|
| PubChem CID | 162371685 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-nitropyrimidin-4-yl] thiocyanate |
| SMILES | N#CSc1ncnc(N2CC3CCCC3C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N5O2S/c13-6-20-12-10(17(18)19)11(14-7-15-12)16-4-8-2-1-3-9(8)5-16/h7-9H,1-5H2 |
| InChIKey | SILAXTXCYICWBO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|