C11H11N3O — CID 162374049
N-(6-ethynyl-3-pyridinyl)azetidine-3-carboxamide (PubChem CID 162374049) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is N-(6-ethynyl-3-pyridinyl)azetidine-3-carboxamide.
| Compound Name | N-(6-ethynyl-3-pyridinyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 162374049 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | N-(6-ethynyl-3-pyridinyl)azetidine-3-carboxamide |
| SMILES | C#Cc1ccc(NC(=O)C2CNC2)cn1 |
| InChI | InChI=1S/C11H11N3O/c1-2-9-3-4-10(7-13-9)14-11(15)8-5-12-6-8/h1,3-4,7-8,12H,5-6H2,(H,14,15) |
| InChIKey | OJFQRJGLKZYGKB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|