C21H22N2O2 — CID 162374208
(1S)-N-benzyl-1-(3,5-dimethoxyphenyl)-1-pyridin-2-ylmethanamine (PubChem CID 162374208) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (1S)-N-benzyl-1-(3,5-dimethoxyphenyl)-1-pyridin-2-ylmethanamine.
| Compound Name | (1S)-N-benzyl-1-(3,5-dimethoxyphenyl)-1-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 162374208 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1S)-N-benzyl-1-(3,5-dimethoxyphenyl)-1-pyridin-2-ylmethanamine |
| SMILES | COc1cc(OC)cc([C@H](NCc2ccccc2)c2ccccn2)c1 |
| InChI | InChI=1S/C21H22N2O2/c1-24-18-12-17(13-19(14-18)25-2)21(20-10-6-7-11-22-20)23-15-16-8-4-3-5-9-16/h3-14,21,23H,15H2,1-2H3/t21-/m0/s1 |
| InChIKey | NPAUECFGCLMCGZ-NRFANRHFSA-N |
| XLogP | 3.98 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |