C16H19FN4OS — CID 162375240
N-cyclobutyl-2-[(2-fluoro-6-methyl-4-pyridinyl)-methylamino]-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 162375240) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is N-cyclobutyl-2-[(2-fluoro-6-methyl-4-pyridinyl)-methylamino]-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-cyclobutyl-2-[(2-fluoro-6-methyl-4-pyridinyl)-methylamino]-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162375240 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-cyclobutyl-2-[(2-fluoro-6-methyl-4-pyridinyl)-methylamino]-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(N(C)c2nc(C(=O)NC3CCC3)c(C)s2)cc(F)n1 |
| InChI | InChI=1S/C16H19FN4OS/c1-9-7-12(8-13(17)18-9)21(3)16-20-14(10(2)23-16)15(22)19-11-5-4-6-11/h7-8,11H,4-6H2,1-3H3,(H,19,22) |
| InChIKey | JAWBKYJZGRPABV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|