C17H16F2N6O3S — CID 175191623
[2-[cyano-(2,6-difluoro-4-pyridinyl)amino]-4-[(2,2-dimethylcyclobutyl)carbamoyl]-1,3-thiazol-5-yl]carbamic acid (PubChem CID 175191623) has the molecular formula C17H16F2N6O3S and a molecular weight of 422.42 g/mol. Its IUPAC name is [2-[cyano-(2,6-difluoro-4-pyridinyl)amino]-4-[(2,2-dimethylcyclobutyl)carbamoyl]-1,3-thiazol-5-yl]carbamic acid.
| Compound Name | [2-[cyano-(2,6-difluoro-4-pyridinyl)amino]-4-[(2,2-dimethylcyclobutyl)carbamoyl]-1,3-thiazol-5-yl]carbamic acid |
|---|---|
| PubChem CID | 175191623 |
| Molecular Formula | C17H16F2N6O3S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | [2-[cyano-(2,6-difluoro-4-pyridinyl)amino]-4-[(2,2-dimethylcyclobutyl)carbamoyl]-1,3-thiazol-5-yl]carbamic acid |
| SMILES | CC1(C)CCC1NC(=O)c1nc(N(C#N)c2cc(F)nc(F)c2)sc1NC(=O)O |
| InChI | InChI=1S/C17H16F2N6O3S/c1-17(2)4-3-9(17)21-13(26)12-14(24-16(27)28)29-15(23-12)25(7-20)8-5-10(18)22-11(19)6-8/h5-6,9,24H,3-4H2,1-2H3,(H,21,26)(H,27,28) |
| InChIKey | VTKCBSLCCLWOGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|