C20H20F2N4O3S — CID 146644944
2-[(2,6-difluoro-4-pyridinyl)-(2-ethynoxyacetyl)amino]-N-(2,2-dimethylcyclobutyl)-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 146644944) has the molecular formula C20H20F2N4O3S and a molecular weight of 434.47 g/mol. Its IUPAC name is 2-[(2,6-difluoro-4-pyridinyl)-(2-ethynoxyacetyl)amino]-N-(2,2-dimethylcyclobutyl)-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2,6-difluoro-4-pyridinyl)-(2-ethynoxyacetyl)amino]-N-(2,2-dimethylcyclobutyl)-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 146644944 |
| Molecular Formula | C20H20F2N4O3S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[(2,6-difluoro-4-pyridinyl)-(2-ethynoxyacetyl)amino]-N-(2,2-dimethylcyclobutyl)-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | C#COCC(=O)N(c1cc(F)nc(F)c1)c1nc(C(=O)NC2CCC2(C)C)c(C)s1 |
| InChI | InChI=1S/C20H20F2N4O3S/c1-5-29-10-16(27)26(12-8-14(21)24-15(22)9-12)19-25-17(11(2)30-19)18(28)23-13-6-7-20(13,3)4/h1,8-9,13H,6-7,10H2,2-4H3,(H,23,28) |
| InChIKey | DOCMCYIVFINPLK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|