C17H19FN4O2 — CID 155350650
N-(2,2-dimethylcyclobutyl)-6-[(2-fluoro-4-pyridinyl)amino]-3-hydroxypyridine-2-carboxamide (PubChem CID 155350650) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclobutyl)-6-[(2-fluoro-4-pyridinyl)amino]-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-(2,2-dimethylcyclobutyl)-6-[(2-fluoro-4-pyridinyl)amino]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 155350650 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-(2,2-dimethylcyclobutyl)-6-[(2-fluoro-4-pyridinyl)amino]-3-hydroxypyridine-2-carboxamide |
| SMILES | CC1(C)CCC1NC(=O)c1nc(Nc2ccnc(F)c2)ccc1O |
| InChI | InChI=1S/C17H19FN4O2/c1-17(2)7-5-12(17)21-16(24)15-11(23)3-4-14(22-15)20-10-6-8-19-13(18)9-10/h3-4,6,8-9,12,23H,5,7H2,1-2H3,(H,21,24)(H,19,20,22) |
| InChIKey | KCVBTCXSIVQBLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|