C16H21N3S — CID 162375594
N'-[(4R)-3-cyano-4-methyl-4-prop-1-en-2-yl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 162375594) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N'-[(4R)-3-cyano-4-methyl-4-prop-1-en-2-yl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(4R)-3-cyano-4-methyl-4-prop-1-en-2-yl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 162375594 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N'-[(4R)-3-cyano-4-methyl-4-prop-1-en-2-yl-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | C=C(C)[C@@]1(C)CCCc2sc(/N=C/N(C)C)c(C#N)c21 |
| InChI | InChI=1S/C16H21N3S/c1-11(2)16(3)8-6-7-13-14(16)12(9-17)15(20-13)18-10-19(4)5/h10H,1,6-8H2,2-5H3/b18-10+/t16-/m1/s1 |
| InChIKey | SEDDHJJBECNVRB-VHWUNXFSSA-N |
| XLogP | 4.01 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|