C15H22N4O3 — CID 162376577
tert-butyl 1-(6-carbamoylpyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 162376577) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is tert-butyl 1-(6-carbamoylpyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-(6-carbamoylpyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 162376577 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | tert-butyl 1-(6-carbamoylpyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCN(c2cc(C(N)=O)ncn2)CC1 |
| InChI | InChI=1S/C15H22N4O3/c1-15(2,3)22-14(21)10-4-6-19(7-5-10)12-8-11(13(16)20)17-9-18-12/h8-10H,4-7H2,1-3H3,(H2,16,20) |
| InChIKey | DKCZOFBULHCFBM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |