C14H20BrN3O2 — CID 139550884
tert-butyl 1-(5-bromopyrazin-2-yl)piperidine-4-carboxylate (PubChem CID 139550884) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is tert-butyl 1-(5-bromopyrazin-2-yl)piperidine-4-carboxylate.
| Compound Name | tert-butyl 1-(5-bromopyrazin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 139550884 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | tert-butyl 1-(5-bromopyrazin-2-yl)piperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCN(c2cnc(Br)cn2)CC1 |
| InChI | InChI=1S/C14H20BrN3O2/c1-14(2,3)20-13(19)10-4-6-18(7-5-10)12-9-16-11(15)8-17-12/h8-10H,4-7H2,1-3H3 |
| InChIKey | WHLYSLDCWLGOIU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |