C18H28N4O2 — CID 166113221
tert-butyl 1-[1-(5-amino-2-pyridinyl)piperidin-4-yl]azetidine-3-carboxylate (PubChem CID 166113221) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl 1-[1-(5-amino-2-pyridinyl)piperidin-4-yl]azetidine-3-carboxylate.
| Compound Name | tert-butyl 1-[1-(5-amino-2-pyridinyl)piperidin-4-yl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 166113221 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl 1-[1-(5-amino-2-pyridinyl)piperidin-4-yl]azetidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CN(C2CCN(c3ccc(N)cn3)CC2)C1 |
| InChI | InChI=1S/C18H28N4O2/c1-18(2,3)24-17(23)13-11-22(12-13)15-6-8-21(9-7-15)16-5-4-14(19)10-20-16/h4-5,10,13,15H,6-9,11-12,19H2,1-3H3 |
| InChIKey | CZDNIGWPBQXYLE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |