C11H19N3O4S — CID 162376612
tert-butyl N-hydroxy-N-[3-hydroxy-1-(5-methyl-1,3,4-thiadiazol-2-yl)propyl]carbamate (PubChem CID 162376612) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[3-hydroxy-1-(5-methyl-1,3,4-thiadiazol-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[3-hydroxy-1-(5-methyl-1,3,4-thiadiazol-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 162376612 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | tert-butyl N-hydroxy-N-[3-hydroxy-1-(5-methyl-1,3,4-thiadiazol-2-yl)propyl]carbamate |
| SMILES | Cc1nnc(C(CCO)N(O)C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C11H19N3O4S/c1-7-12-13-9(19-7)8(5-6-15)14(17)10(16)18-11(2,3)4/h8,15,17H,5-6H2,1-4H3 |
| InChIKey | SMYABBMUIIUIMR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|