C16H13ClF3N3O2 — CID 162376913
N-[3-chloro-4-(trifluoromethyl)phenyl]-6-oxido-3,4-dihydro-1H-2,6-naphthyridin-6-ium-2-carboxamide (PubChem CID 162376913) has the molecular formula C16H13ClF3N3O2 and a molecular weight of 371.75 g/mol. Its IUPAC name is N-[3-chloro-4-(trifluoromethyl)phenyl]-6-oxido-3,4-dihydro-1H-2,6-naphthyridin-6-ium-2-carboxamide.
| Compound Name | N-[3-chloro-4-(trifluoromethyl)phenyl]-6-oxido-3,4-dihydro-1H-2,6-naphthyridin-6-ium-2-carboxamide |
|---|---|
| PubChem CID | 162376913 |
| Molecular Formula | C16H13ClF3N3O2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[3-chloro-4-(trifluoromethyl)phenyl]-6-oxido-3,4-dihydro-1H-2,6-naphthyridin-6-ium-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(Cl)c1)N1CCc2c[n+]([O-])ccc2C1 |
| InChI | InChI=1S/C16H13ClF3N3O2/c17-14-7-12(1-2-13(14)16(18,19)20)21-15(24)22-5-3-11-9-23(25)6-4-10(11)8-22/h1-2,4,6-7,9H,3,5,8H2,(H,21,24) |
| InChIKey | OSMOBHFAVXHULA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|