C15H12Cl2FN3O — CID 162376975
N-(3,4-dichlorophenyl)-6-fluoro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide (PubChem CID 162376975) has the molecular formula C15H12Cl2FN3O and a molecular weight of 340.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-fluoro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-fluoro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 162376975 |
| Molecular Formula | C15H12Cl2FN3O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-fluoro-3,4-dihydro-1H-2,7-naphthyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CCc2cc(F)ncc2C1 |
| InChI | InChI=1S/C15H12Cl2FN3O/c16-12-2-1-11(6-13(12)17)20-15(22)21-4-3-9-5-14(18)19-7-10(9)8-21/h1-2,5-7H,3-4,8H2,(H,20,22) |
| InChIKey | UAMRZXZOGKPFKT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|