C25H31Cl2N3O2 — CID 11754733
N-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide (PubChem CID 11754733) has the molecular formula C25H31Cl2N3O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 11754733 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-(3,4-dichlorophenyl)-7-(3-piperidin-1-ylpropoxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CCc2ccc(OCCCN3CCCCC3)cc2CC1 |
| InChI | InChI=1S/C25H31Cl2N3O2/c26-23-8-6-21(18-24(23)27)28-25(31)30-14-9-19-5-7-22(17-20(19)10-15-30)32-16-4-13-29-11-2-1-3-12-29/h5-8,17-18H,1-4,9-16H2,(H,28,31) |
| InChIKey | APQZEKKGBCHLJB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|