C26H33Cl2N3O2 — CID 152646882
(3,4-dichlorophenyl)-[4-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 152646882) has the molecular formula C26H33Cl2N3O2 and a molecular weight of 490.48 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 152646882 |
| Molecular Formula | C26H33Cl2N3O2 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCN(Cc2ccc(OCCCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H33Cl2N3O2/c27-24-10-7-22(19-25(24)28)26(32)31-16-14-30(15-17-31)20-21-5-8-23(9-6-21)33-18-4-13-29-11-2-1-3-12-29/h5-10,19H,1-4,11-18,20H2 |
| InChIKey | ZGSPTTSRMWHWAV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|