C20H18F2N8O5 — CID 162378032
[(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-[[(1R,2R)-2-nitrocyclopropanecarbonyl]amino]-2-pyridinyl]triazol-4-yl]carbamate (PubChem CID 162378032) has the molecular formula C20H18F2N8O5 and a molecular weight of 488.41 g/mol. Its IUPAC name is [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-[[(1R,2R)-2-nitrocyclopropanecarbonyl]amino]-2-pyridinyl]triazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-[[(1R,2R)-2-nitrocyclopropanecarbonyl]amino]-2-pyridinyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 162378032 |
| Molecular Formula | C20H18F2N8O5 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [(1R)-1-(2,5-difluoro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-[[(1R,2R)-2-nitrocyclopropanecarbonyl]amino]-2-pyridinyl]triazol-4-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(NC(=O)[C@@H]3C[C@H]3[N+](=O)[O-])cn2)nnn1C)c1cc(F)cnc1F |
| InChI | InChI=1S/C20H18F2N8O5/c1-9(12-5-10(21)7-24-17(12)22)35-20(32)26-18-16(27-28-29(18)2)14-4-3-11(8-23-14)25-19(31)13-6-15(13)30(33)34/h3-5,7-9,13,15H,6H2,1-2H3,(H,25,31)(H,26,32)/t9-,13-,15-/m1/s1 |
| InChIKey | UMSBFJLYTLLCNQ-XXLQHYSLSA-N |
| XLogP | 2.46 |
| TPSA | 167.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|