C16H15ClFN7O2 — CID 162377639
[(1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethyl] N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate (PubChem CID 162377639) has the molecular formula C16H15ClFN7O2 and a molecular weight of 391.79 g/mol. Its IUPAC name is [(1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethyl] N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethyl] N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 162377639 |
| Molecular Formula | C16H15ClFN7O2 |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(1R)-1-(5-chloro-2-fluoro-3-pyridinyl)ethyl] N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(N)cn2)nnn1C)c1cc(Cl)cnc1F |
| InChI | InChI=1S/C16H15ClFN7O2/c1-8(11-5-9(17)6-21-14(11)18)27-16(26)22-15-13(23-24-25(15)2)12-4-3-10(19)7-20-12/h3-8H,19H2,1-2H3,(H,22,26)/t8-/m1/s1 |
| InChIKey | SSPSFGLENSLFGQ-MRVPVSSYSA-N |
| XLogP | 2.96 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|