C11H15ClN6O2 — CID 175905968
ethyl N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate;hydrochloride (PubChem CID 175905968) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is ethyl N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate;hydrochloride.
| Compound Name | ethyl N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 175905968 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl N-[5-(5-amino-2-pyridinyl)-3-methyltriazol-4-yl]carbamate;hydrochloride |
| SMILES | CCOC(=O)Nc1c(-c2ccc(N)cn2)nnn1C.Cl |
| InChI | InChI=1S/C11H14N6O2.ClH/c1-3-19-11(18)14-10-9(15-16-17(10)2)8-5-4-7(12)6-13-8;/h4-6H,3,12H2,1-2H3,(H,14,18);1H |
| InChIKey | GMKPMBMMGIXZNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |