C15H15ClN6O3 — CID 174218168
[5-[5-[(3-chloro-1-bicyclo[1.1.1]pentanyl)carbamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamic acid (PubChem CID 174218168) has the molecular formula C15H15ClN6O3 and a molecular weight of 362.78 g/mol. Its IUPAC name is [5-[5-[(3-chloro-1-bicyclo[1.1.1]pentanyl)carbamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamic acid.
| Compound Name | [5-[5-[(3-chloro-1-bicyclo[1.1.1]pentanyl)carbamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174218168 |
| Molecular Formula | C15H15ClN6O3 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [5-[5-[(3-chloro-1-bicyclo[1.1.1]pentanyl)carbamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamic acid |
| SMILES | Cn1nnc(-c2ccc(C(=O)NC34CC(Cl)(C3)C4)cn2)c1NC(=O)O |
| InChI | InChI=1S/C15H15ClN6O3/c1-22-11(18-13(24)25)10(20-21-22)9-3-2-8(4-17-9)12(23)19-15-5-14(16,6-15)7-15/h2-4,18H,5-7H2,1H3,(H,19,23)(H,24,25) |
| InChIKey | PVKWNWGZPRSZGP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|