C22H24ClN7O3 — CID 167273006
[(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-(3-methylbut-3-enylcarbamoyl)-2-pyridinyl]triazol-4-yl]carbamate (PubChem CID 167273006) has the molecular formula C22H24ClN7O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-(3-methylbut-3-enylcarbamoyl)-2-pyridinyl]triazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-(3-methylbut-3-enylcarbamoyl)-2-pyridinyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 167273006 |
| Molecular Formula | C22H24ClN7O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[3-methyl-5-[5-(3-methylbut-3-enylcarbamoyl)-2-pyridinyl]triazol-4-yl]carbamate |
| SMILES | C=C(C)CCNC(=O)c1ccc(-c2nnn(C)c2NC(=O)O[C@H](C)c2cccnc2Cl)nc1 |
| InChI | InChI=1S/C22H24ClN7O3/c1-13(2)9-11-25-21(31)15-7-8-17(26-12-15)18-20(30(4)29-28-18)27-22(32)33-14(3)16-6-5-10-24-19(16)23/h5-8,10,12,14H,1,9,11H2,2-4H3,(H,25,31)(H,27,32)/t14-/m1/s1 |
| InChIKey | JIBYKHNPPVMGBV-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|