C22H21ClN8O3 — CID 167301985
[(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[5-(4-cyanopent-4-enoylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate (PubChem CID 167301985) has the molecular formula C22H21ClN8O3 and a molecular weight of 480.92 g/mol. Its IUPAC name is [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[5-(4-cyanopent-4-enoylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[5-(4-cyanopent-4-enoylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 167301985 |
| Molecular Formula | C22H21ClN8O3 |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | [(1R)-1-(2-chloro-3-pyridinyl)ethyl] N-[5-[5-(4-cyanopent-4-enoylamino)-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
| SMILES | C=C(C#N)CCC(=O)Nc1ccc(-c2nnn(C)c2NC(=O)O[C@H](C)c2cccnc2Cl)nc1 |
| InChI | InChI=1S/C22H21ClN8O3/c1-13(11-24)6-9-18(32)27-15-7-8-17(26-12-15)19-21(31(3)30-29-19)28-22(33)34-14(2)16-5-4-10-25-20(16)23/h4-5,7-8,10,12,14H,1,6,9H2,2-3H3,(H,27,32)(H,28,33)/t14-/m1/s1 |
| InChIKey | BTSNCXHYMZOEKB-CQSZACIVSA-N |
| XLogP | 4.03 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|