C15H17F3N2O — CID 162378159
(1R)-1-[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]ethanol (PubChem CID 162378159) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is (1R)-1-[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]ethanol.
| Compound Name | (1R)-1-[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 162378159 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (1R)-1-[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]ethanol |
| SMILES | CC(C)n1cc(C(F)(F)F)nc1-c1ccc([C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H17F3N2O/c1-9(2)20-8-13(15(16,17)18)19-14(20)12-6-4-11(5-7-12)10(3)21/h4-10,21H,1-3H3/t10-/m1/s1 |
| InChIKey | LYCTXDQKZHMGOI-SNVBAGLBSA-N |
| XLogP | 4.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |