C10H9NO2S — CID 162379786
methyl 2-(1,3-benzothiazol-7-yl)acetate (PubChem CID 162379786) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazol-7-yl)acetate.
| Compound Name | methyl 2-(1,3-benzothiazol-7-yl)acetate |
|---|---|
| PubChem CID | 162379786 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | methyl 2-(1,3-benzothiazol-7-yl)acetate |
| SMILES | COC(=O)Cc1cccc2ncsc12 |
| InChI | InChI=1S/C10H9NO2S/c1-13-9(12)5-7-3-2-4-8-10(7)14-6-11-8/h2-4,6H,5H2,1H3 |
| InChIKey | VEWSLANAHAFBOY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |