C19H18F4N2 — CID 162379901
2-[2-fluoro-4-(trifluoromethyl)phenyl]-6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptane (PubChem CID 162379901) has the molecular formula C19H18F4N2 and a molecular weight of 350.36 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethyl)phenyl]-6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptane.
| Compound Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 162379901 |
| Molecular Formula | C19H18F4N2 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]-6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptane |
| SMILES | Fc1cc(C(F)(F)F)ccc1N1CC2(CC(Cc3cccnc3)C2)C1 |
| InChI | InChI=1S/C19H18F4N2/c20-16-7-15(19(21,22)23)3-4-17(16)25-11-18(12-25)8-14(9-18)6-13-2-1-5-24-10-13/h1-5,7,10,14H,6,8-9,11-12H2 |
| InChIKey | PYCWTUJCVOHTLJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |