C19H18FN3 — CID 162379898
2-fluoro-4-[6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptan-2-yl]benzonitrile (PubChem CID 162379898) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-fluoro-4-[6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptan-2-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 162379898 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-fluoro-4-[6-(pyridin-3-ylmethyl)-2-azaspiro[3.3]heptan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CC3(CC(Cc4cccnc4)C3)C2)cc1F |
| InChI | InChI=1S/C19H18FN3/c20-18-7-17(4-3-16(18)10-21)23-12-19(13-23)8-15(9-19)6-14-2-1-5-22-11-14/h1-5,7,11,15H,6,8-9,12-13H2 |
| InChIKey | UOSXJZFQPJOFNW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |