C14H20BrN5O3 — CID 162380647
3-bromo-5-(2-methoxyethylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 162380647) has the molecular formula C14H20BrN5O3 and a molecular weight of 386.25 g/mol. Its IUPAC name is 3-bromo-5-(2-methoxyethylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-bromo-5-(2-methoxyethylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162380647 |
| Molecular Formula | C14H20BrN5O3 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-bromo-5-(2-methoxyethylamino)-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CC[C@H](n2nc(Br)c(C(N)=O)c2NCCOC)C1 |
| InChI | InChI=1S/C14H20BrN5O3/c1-3-10(21)19-6-4-9(8-19)20-14(17-5-7-23-2)11(13(16)22)12(15)18-20/h3,9,17H,1,4-8H2,2H3,(H2,16,22)/t9-/m0/s1 |
| InChIKey | CYCVQTHVMVJUFZ-VIFPVBQESA-N |
| XLogP | 0.76 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|