C16H26BrN5O4 — CID 162380650
tert-butyl (3S)-3-[3-bromo-4-carbamoyl-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 162380650) has the molecular formula C16H26BrN5O4 and a molecular weight of 432.32 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-bromo-4-carbamoyl-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[3-bromo-4-carbamoyl-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162380650 |
| Molecular Formula | C16H26BrN5O4 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | tert-butyl (3S)-3-[3-bromo-4-carbamoyl-5-(2-methoxyethylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | COCCNc1c(C(N)=O)c(Br)nn1[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26BrN5O4/c1-16(2,3)26-15(24)21-7-5-10(9-21)22-14(19-6-8-25-4)11(13(18)23)12(17)20-22/h10,19H,5-9H2,1-4H3,(H2,18,23)/t10-/m0/s1 |
| InChIKey | SHMRPSRSJPWLIZ-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|