C20H31BrN6O3 — CID 162380710
tert-butyl (3S)-3-[3-bromo-4-cyano-5-(3-morpholin-4-ylpropylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 162380710) has the molecular formula C20H31BrN6O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-bromo-4-cyano-5-(3-morpholin-4-ylpropylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[3-bromo-4-cyano-5-(3-morpholin-4-ylpropylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162380710 |
| Molecular Formula | C20H31BrN6O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | tert-butyl (3S)-3-[3-bromo-4-cyano-5-(3-morpholin-4-ylpropylamino)pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](n2nc(Br)c(C#N)c2NCCCN2CCOCC2)C1 |
| InChI | InChI=1S/C20H31BrN6O3/c1-20(2,3)30-19(28)26-8-5-15(14-26)27-18(16(13-22)17(21)24-27)23-6-4-7-25-9-11-29-12-10-25/h15,23H,4-12,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | AXNWTHGYUAXGKM-HNNXBMFYSA-N |
| XLogP | 2.83 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|