About CID 162380704
CID 162380704 (PubChem CID 162380704) has the molecular formula C16H22N5O3Si-
and a molecular weight of 360.47 g/mol.
Molecular Properties
| Compound Name | CID 162380704 |
| PubChem CID | 162380704 |
| Molecular Formula | C16H22N5O3Si- |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | — |
| SMILES | C#Cc1nn([C@@]2([Si-])C[C@H](COC)N(C(=O)C=C)C2)c(NC)c1C(N)O |
| InChI | InChI=1S/C16H22N5O3Si/c1-5-11-13(14(17)23)15(18-3)21(19-11)16(25)7-10(8-24-4)20(9-16)12(22)6-2/h1,6,10,14,18,23H,2,7-9,17H2,3-4H3/q-1/t10-,14?,16-/m1/s1 |
| InChIKey | GWGLGKPXDLLESL-FGOGKNADSA-N |
| XLogP | -0.89 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162380704 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162380704?
The IUPAC name of CID 162380704 (CID 162380704) is not available.
What is the SMILES notation for CID 162380704?
The canonical SMILES for CID 162380704 is C#Cc1nn([C@@]2([Si-])C[C@H](COC)N(C(=O)C=C)C2)c(NC)c1C(N)O.
What is the InChIKey of CID 162380704?
The InChIKey is GWGLGKPXDLLESL-FGOGKNADSA-N. The full InChI is InChI=1S/C16H22N5O3Si/c1-5-11-13(14(17)23)15(18-3)21(19-11)16(25)7-10(8-24-4)20(9-16)12(22)6-2/h1,6,10,14,18,23H,2,7-9,17H2,3-4H3/q-1/t10-,14?,16-/m1/s1.
What are the key properties of CID 162380704?
CID 162380704 has a molecular weight of 360.47 g/mol, XLogP of -0.89, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162380704 is sourced from PubChem (CID 162380704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).