C13H21N5O2 — CID 167082061
amino-[3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)pyrrolidin-3-yl]-5-(methylamino)pyrazol-4-yl]methanol (PubChem CID 167082061) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is amino-[3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)pyrrolidin-3-yl]-5-(methylamino)pyrazol-4-yl]methanol.
| Compound Name | amino-[3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)pyrrolidin-3-yl]-5-(methylamino)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 167082061 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | amino-[3-ethynyl-1-[(3S,5R)-5-(methoxymethyl)pyrrolidin-3-yl]-5-(methylamino)pyrazol-4-yl]methanol |
| SMILES | C#Cc1nn([C@@H]2CN[C@@H](COC)C2)c(NC)c1C(N)O |
| InChI | InChI=1S/C13H21N5O2/c1-4-10-11(12(14)19)13(15-2)18(17-10)9-5-8(7-20-3)16-6-9/h1,8-9,12,15-16,19H,5-7,14H2,2-3H3/t8-,9+,12?/m1/s1 |
| InChIKey | JVMQTGLHNJDIKN-RLBMWQAVSA-N |
| XLogP | -0.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|