C6H9BrN4O2 — CID 162380724
5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide (PubChem CID 162380724) has the molecular formula C6H9BrN4O2 and a molecular weight of 249.07 g/mol. Its IUPAC name is 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162380724 |
| Molecular Formula | C6H9BrN4O2 |
| Molecular Weight | 249.07 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(NCCO)n[nH]c1Br |
| InChI | InChI=1S/C6H9BrN4O2/c7-4-3(5(8)13)6(11-10-4)9-1-2-12/h12H,1-2H2,(H2,8,13)(H2,9,10,11) |
| InChIKey | FSFCKAIXXRIRAN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.07 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |