C15H26BrN5O3 — CID 162381943
5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 162381943) has the molecular formula C15H26BrN5O3 and a molecular weight of 404.31 g/mol. Its IUPAC name is 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 162381943 |
| Molecular Formula | C15H26BrN5O3 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 5-bromo-3-(2-hydroxyethylamino)-1H-pyrazole-4-carboxamide;ethane;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1.CC.NC(=O)c1c(NCCO)n[nH]c1Br |
| InChI | InChI=1S/C7H11NO.C6H9BrN4O2.C2H6/c1-2-7(9)8-5-3-4-6-8;7-4-3(5(8)13)6(11-10-4)9-1-2-12;1-2/h2H,1,3-6H2;12H,1-2H2,(H2,8,13)(H2,9,10,11);1-2H3 |
| InChIKey | DIXXEQNGWIIOBG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|