C14H22BrN5O3 — CID 162380912
5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 162380912) has the molecular formula C14H22BrN5O3 and a molecular weight of 388.27 g/mol. Its IUPAC name is 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162380912 |
| Molecular Formula | C14H22BrN5O3 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-bromo-3-(methylamino)-1H-pyrazole-4-carboxamide;1-[2-(methoxymethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC1COC.CNc1n[nH]c(Br)c1C(N)=O |
| InChI | InChI=1S/C9H15NO2.C5H7BrN4O/c1-3-9(11)10-6-4-5-8(10)7-12-2;1-8-5-2(4(7)11)3(6)9-10-5/h3,8H,1,4-7H2,2H3;1H3,(H2,7,11)(H2,8,9,10) |
| InChIKey | ONXCUGWNEFXEQJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|