C14H19BrN5O3Si — CID 162381194
CID 162381194 (PubChem CID 162381194) has the molecular formula C14H19BrN5O3Si and a molecular weight of 413.33 g/mol.
| Compound Name | CID 162381194 |
|---|---|
| PubChem CID | 162381194 |
| Molecular Formula | C14H19BrN5O3Si |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[C@@]([Si])(n2nc(Br)c(C(N)=O)c2NC)C[C@@H]1COC |
| InChI | InChI=1S/C14H19BrN5O3Si/c1-4-9(21)19-7-14(24,5-8(19)6-23-3)20-13(17-2)10(12(16)22)11(15)18-20/h4,8,17H,1,5-7H2,2-3H3,(H2,16,22)/t8-,14-/m1/s1 |
| InChIKey | KWHFNRSQTUTIQP-XLKFXECMSA-N |
| XLogP | 0.04 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|