C11H17BrN5O2Si — CID 162380654
CID 162380654 (PubChem CID 162380654) has the molecular formula C11H17BrN5O2Si and a molecular weight of 359.28 g/mol.
| Compound Name | CID 162380654 |
|---|---|
| PubChem CID | 162380654 |
| Molecular Formula | C11H17BrN5O2Si |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | — |
| SMILES | CNc1c(C(N)=O)c(Br)nn1[C@]1([Si])CN[C@@H](C(C)O)C1 |
| InChI | InChI=1S/C11H17BrN5O2Si/c1-5(18)6-3-11(20,4-15-6)17-10(14-2)7(9(13)19)8(12)16-17/h5-6,14-15,18H,3-4H2,1-2H3,(H2,13,19)/t5?,6-,11-/m1/s1 |
| InChIKey | OHAXDBDYRMCPDX-GHLOERTESA-N |
| XLogP | -0.65 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|